C23H23N3O — CID 175251032
N-[4-[(2S)-4-(2-phenylethenyl)morpholin-2-yl]phenyl]pyridin-2-amine (PubChem CID 175251032) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[4-[(2S)-4-(2-phenylethenyl)morpholin-2-yl]phenyl]pyridin-2-amine.
| Compound Name | N-[4-[(2S)-4-(2-phenylethenyl)morpholin-2-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 175251032 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[4-[(2S)-4-(2-phenylethenyl)morpholin-2-yl]phenyl]pyridin-2-amine |
| SMILES | C(=CN1CCO[C@@H](c2ccc(Nc3ccccn3)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O/c1-2-6-19(7-3-1)13-15-26-16-17-27-22(18-26)20-9-11-21(12-10-20)25-23-8-4-5-14-24-23/h1-15,22H,16-18H2,(H,24,25)/t22-/m1/s1 |
| InChIKey | BSNOSVNAGLEOJQ-JOCHJYFZSA-N |
| XLogP | 4.87 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |