C28H27N3O — CID 44573577
5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-N-(4-phenylphenyl)pyridin-2-amine (PubChem CID 44573577) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is 5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-N-(4-phenylphenyl)pyridin-2-amine.
| Compound Name | 5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-N-(4-phenylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 44573577 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 5-[[(2S)-2-phenylmorpholin-4-yl]methyl]-N-(4-phenylphenyl)pyridin-2-amine |
| SMILES | c1ccc(-c2ccc(Nc3ccc(CN4CCO[C@@H](c5ccccc5)C4)cn3)cc2)cc1 |
| InChI | InChI=1S/C28H27N3O/c1-3-7-23(8-4-1)24-12-14-26(15-13-24)30-28-16-11-22(19-29-28)20-31-17-18-32-27(21-31)25-9-5-2-6-10-25/h1-16,19,27H,17-18,20-21H2,(H,29,30)/t27-/m1/s1 |
| InChIKey | XDIHBXHIHGKJEY-HHHXNRCGSA-N |
| XLogP | 6.07 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |