C22H22ClN3O — CID 24955167
N-(3-chlorophenyl)-5-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyridin-2-amine (PubChem CID 24955167) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyridin-2-amine.
| Compound Name | N-(3-chlorophenyl)-5-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 24955167 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(3-chlorophenyl)-5-[[(2S)-2-phenylmorpholin-4-yl]methyl]pyridin-2-amine |
| SMILES | Clc1cccc(Nc2ccc(CN3CCO[C@@H](c4ccccc4)C3)cn2)c1 |
| InChI | InChI=1S/C22H22ClN3O/c23-19-7-4-8-20(13-19)25-22-10-9-17(14-24-22)15-26-11-12-27-21(16-26)18-5-2-1-3-6-18/h1-10,13-14,21H,11-12,15-16H2,(H,24,25)/t21-/m1/s1 |
| InChIKey | FAIVQHLLKCILCJ-OAQYLSRUSA-N |
| XLogP | 5.05 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |