C14H16N4O3 — CID 125008509
(6-methoxy-3-pyridinyl)-[(3R)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 125008509) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is (6-methoxy-3-pyridinyl)-[(3R)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (6-methoxy-3-pyridinyl)-[(3R)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 125008509 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (6-methoxy-3-pyridinyl)-[(3R)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCOC[C@H]2c2ccn[nH]2)cn1 |
| InChI | InChI=1S/C14H16N4O3/c1-20-13-3-2-10(8-15-13)14(19)18-6-7-21-9-12(18)11-4-5-16-17-11/h2-5,8,12H,6-7,9H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | UVLLAYMKZBMMSV-LBPRGKRZSA-N |
| XLogP | 1.03 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |