C17H30O5 — CID 12500891
3,4,4-tributoxy-2-methoxycyclobut-2-en-1-one (PubChem CID 12500891) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 3,4,4-tributoxy-2-methoxycyclobut-2-en-1-one.
| Compound Name | 3,4,4-tributoxy-2-methoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 12500891 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3,4,4-tributoxy-2-methoxycyclobut-2-en-1-one |
| SMILES | CCCCOC1=C(OC)C(=O)C1(OCCCC)OCCCC |
| InChI | InChI=1S/C17H30O5/c1-5-8-11-20-16-14(19-4)15(18)17(16,21-12-9-6-2)22-13-10-7-3/h5-13H2,1-4H3 |
| InChIKey | NQYXZADCPAWSIZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|