C16H24O5 — CID 135024069
1,2-dibutoxy-5,10-dioxaspiro[3.6]deca-1,7-dien-3-one (PubChem CID 135024069) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 1,2-dibutoxy-5,10-dioxaspiro[3.6]deca-1,7-dien-3-one.
| Compound Name | 1,2-dibutoxy-5,10-dioxaspiro[3.6]deca-1,7-dien-3-one |
|---|---|
| PubChem CID | 135024069 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1,2-dibutoxy-5,10-dioxaspiro[3.6]deca-1,7-dien-3-one |
| SMILES | CCCCOC1=C(OCCCC)C2(OCC=CCO2)C1=O |
| InChI | InChI=1S/C16H24O5/c1-3-5-9-18-13-14(17)16(15(13)19-10-6-4-2)20-11-7-8-12-21-16/h7-8H,3-6,9-12H2,1-2H3 |
| InChIKey | GKCVXMTWHRLLRO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|