bis(trimethylsilyl) hydrogen phosphite

C6H19O3PSi2 — CID 12501110

IUPACbis(trimethylsilyl) hydrogen phosphite
SMILESC[Si](C)(C)OP(O)O[Si](C)(C)C
InChIInChI=1S/C6H19O3PSi2/c1-11(2,3)8-10(7)9-12(4,5)6/h7H,1-6H3
InChIKeyTVYLOQJEHUAACN-UHFFFAOYSA-N
MW226.36 g/mol
LogP2.91
Rot. Bonds4

About bis(trimethylsilyl) hydrogen phosphite

bis(trimethylsilyl) hydrogen phosphite (PubChem CID 12501110) has the molecular formula C6H19O3PSi2 and a molecular weight of 226.36 g/mol. Its IUPAC name is bis(trimethylsilyl) hydrogen phosphite.

Molecular Properties

Compound Namebis(trimethylsilyl) hydrogen phosphite
PubChem CID12501110
Molecular FormulaC6H19O3PSi2
Molecular Weight226.36 g/mol
Exact Mass226.06
IUPAC Namebis(trimethylsilyl) hydrogen phosphite
SMILESC[Si](C)(C)OP(O)O[Si](C)(C)C
InChIInChI=1S/C6H19O3PSi2/c1-11(2,3)8-10(7)9-12(4,5)6/h7H,1-6H3
InChIKeyTVYLOQJEHUAACN-UHFFFAOYSA-N
XLogP2.91
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.36
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(trimethylsilyl) hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(trimethylsilyl) hydrogen phosphite?
The IUPAC name of bis(trimethylsilyl) hydrogen phosphite (CID 12501110) is bis(trimethylsilyl) hydrogen phosphite.
What is the SMILES notation for bis(trimethylsilyl) hydrogen phosphite?
The canonical SMILES for bis(trimethylsilyl) hydrogen phosphite is C[Si](C)(C)OP(O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) hydrogen phosphite?
The InChIKey is TVYLOQJEHUAACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19O3PSi2/c1-11(2,3)8-10(7)9-12(4,5)6/h7H,1-6H3.
What are the key properties of bis(trimethylsilyl) hydrogen phosphite?
bis(trimethylsilyl) hydrogen phosphite has a molecular weight of 226.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) hydrogen phosphite is sourced from PubChem (CID 12501110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).