C14H23N3O2S — CID 125013427
(3S)-1-cyclopentylsulfonyl-3-(1H-pyrazol-5-ylmethyl)piperidine (PubChem CID 125013427) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is (3S)-1-cyclopentylsulfonyl-3-(1H-pyrazol-5-ylmethyl)piperidine.
| Compound Name | (3S)-1-cyclopentylsulfonyl-3-(1H-pyrazol-5-ylmethyl)piperidine |
|---|---|
| PubChem CID | 125013427 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (3S)-1-cyclopentylsulfonyl-3-(1H-pyrazol-5-ylmethyl)piperidine |
| SMILES | O=S(=O)(C1CCCC1)N1CCC[C@@H](Cc2ccn[nH]2)C1 |
| InChI | InChI=1S/C14H23N3O2S/c18-20(19,14-5-1-2-6-14)17-9-3-4-12(11-17)10-13-7-8-15-16-13/h7-8,12,14H,1-6,9-11H2,(H,15,16)/t12-/m0/s1 |
| InChIKey | WFCJOTXRZFWCDD-LBPRGKRZSA-N |
| XLogP | 1.94 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |