About 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine
3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine (PubChem CID 125013873) has the molecular formula C13H18N6O3S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine |
| PubChem CID | 125013873 |
| Molecular Formula | C13H18N6O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCO[C@H](c2nccnc2N)C1 |
| InChI | InChI=1S/C13H18N6O3S/c1-9-11(8-18(2)17-9)23(20,21)19-5-6-22-10(7-19)12-13(14)16-4-3-15-12/h3-4,8,10H,5-7H2,1-2H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | WIHAUFYSZYOKBO-JTQLQIEISA-N |
| XLogP | -0.14 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine?
The IUPAC name of 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine (CID 125013873) is 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine.
What is the SMILES notation for 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine?
The canonical SMILES for 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine is Cc1nn(C)cc1S(=O)(=O)N1CCO[C@H](c2nccnc2N)C1.
What is the InChIKey of 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine?
The InChIKey is WIHAUFYSZYOKBO-JTQLQIEISA-N. The full InChI is InChI=1S/C13H18N6O3S/c1-9-11(8-18(2)17-9)23(20,21)19-5-6-22-10(7-19)12-13(14)16-4-3-15-12/h3-4,8,10H,5-7H2,1-2H3,(H2,14,16)/t10-/m0/s1.
What are the key properties of 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine?
3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine has a molecular weight of 338.39 g/mol, XLogP of -0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-4-(1,3-dimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]pyrazin-2-amine is sourced from PubChem (CID 125013873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).