C12H19N5O4S — CID 110112753
3-(4-morpholin-4-ylsulfonylmorpholin-2-yl)pyrazin-2-amine (PubChem CID 110112753) has the molecular formula C12H19N5O4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylmorpholin-2-yl)pyrazin-2-amine.
| Compound Name | 3-(4-morpholin-4-ylsulfonylmorpholin-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 110112753 |
| Molecular Formula | C12H19N5O4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylmorpholin-2-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1C1CN(S(=O)(=O)N2CCOCC2)CCO1 |
| InChI | InChI=1S/C12H19N5O4S/c13-12-11(14-1-2-15-12)10-9-17(5-8-21-10)22(18,19)16-3-6-20-7-4-16/h1-2,10H,3-9H2,(H2,13,15) |
| InChIKey | IXRHYWHEQIYTNV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |