C28H50O4S — CID 125030538
[(3R,5R,8S,9S,10R,13R,14R,17S)-5-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate (PubChem CID 125030538) has the molecular formula C28H50O4S and a molecular weight of 482.77 g/mol. Its IUPAC name is [(3R,5R,8S,9S,10R,13R,14R,17S)-5-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate.
| Compound Name | [(3R,5R,8S,9S,10R,13R,14R,17S)-5-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 125030538 |
| Molecular Formula | C28H50O4S |
| Molecular Weight | 482.77 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | [(3R,5R,8S,9S,10R,13R,14R,17S)-5-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@@]4(O)C[C@H](OS(C)(=O)=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H50O4S/c1-19(2)8-7-9-20(3)23-10-11-24-22-13-17-28(29)18-21(32-33(6,30)31)12-16-27(28,5)25(22)14-15-26(23,24)4/h19-25,29H,7-18H2,1-6H3/t20-,21-,22+,23+,24-,25+,26-,27-,28-/m1/s1 |
| InChIKey | GZAQNXZLFPMULH-FPNSHKDBSA-N |
| XLogP | 6.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|