C27H46O2 — CID 125030816
(1R,2R,4R,6S,8R,11S,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-8-ol (PubChem CID 125030816) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is (1R,2R,4R,6S,8R,11S,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-8-ol.
| Compound Name | (1R,2R,4R,6S,8R,11S,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-8-ol |
|---|---|
| PubChem CID | 125030816 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (1R,2R,4R,6S,8R,11S,12R,15S,16S)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-8-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@@]4(O)C[C@@H]5O[C@@H]5C[C@]4(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)20-9-10-21-19-11-14-27(28)16-24-23(29-24)15-26(27,5)22(19)12-13-25(20,21)4/h17-24,28H,6-16H2,1-5H3/t18-,19+,20+,21-,22-,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | JGCBUDSKGHJASF-UCSPKVETSA-N |
| XLogP | 6.60 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|