C25H36O7 — CID 125030712
[(5S,6S,8S,9R,10R,13S,14S,16R)-6,16-diacetyloxy-10-methyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl acetate (PubChem CID 125030712) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(5S,6S,8S,9R,10R,13S,14S,16R)-6,16-diacetyloxy-10-methyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl acetate.
| Compound Name | [(5S,6S,8S,9R,10R,13S,14S,16R)-6,16-diacetyloxy-10-methyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl acetate |
|---|---|
| PubChem CID | 125030712 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [(5S,6S,8S,9R,10R,13S,14S,16R)-6,16-diacetyloxy-10-methyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-13-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CC[C@@H]3[C@H](C[C@H](OC(C)=O)[C@H]4CC(=O)CC[C@]34C)[C@@H]1C[C@@H](OC(C)=O)C2 |
| InChI | InChI=1S/C25H36O7/c1-14(26)30-13-25-8-6-20-19(21(25)10-18(12-25)31-15(2)27)11-23(32-16(3)28)22-9-17(29)5-7-24(20,22)4/h18-23H,5-13H2,1-4H3/t18-,19+,20-,21+,22-,23+,24-,25-/m1/s1 |
| InChIKey | IHYPOAFAUZNFQR-WLSGSUDNSA-N |
| XLogP | 3.61 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|