C25H37BrO5 — CID 125031042
(5S,8S,9R,10S,13S,14R,17R)-9-bromo-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one (PubChem CID 125031042) has the molecular formula C25H37BrO5 and a molecular weight of 497.47 g/mol. Its IUPAC name is (5S,8S,9R,10S,13S,14R,17R)-9-bromo-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one.
| Compound Name | (5S,8S,9R,10S,13S,14R,17R)-9-bromo-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one |
|---|---|
| PubChem CID | 125031042 |
| Molecular Formula | C25H37BrO5 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (5S,8S,9R,10S,13S,14R,17R)-9-bromo-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one |
| SMILES | CC1([C@@H]2CC[C@@H]3[C@@H]4CC[C@H]5CC6(CC[C@]5(C)[C@@]4(Br)C(=O)C[C@@]32C)OCCO6)OCCO1 |
| InChI | InChI=1S/C25H37BrO5/c1-21-15-20(27)25(26)18(17(21)6-7-19(21)23(3)28-10-11-29-23)5-4-16-14-24(30-12-13-31-24)9-8-22(16,25)2/h16-19H,4-15H2,1-3H3/t16-,17+,18-,19+,21-,22-,25-/m0/s1 |
| InChIKey | LGPAHKPSYJDVFT-AZXLKLIUSA-N |
| XLogP | 4.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|