C21H31BrO3 — CID 125031025
(5S,8R,9R,10S,13R,14R)-9-bromo-10,13-dimethylspiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one (PubChem CID 125031025) has the molecular formula C21H31BrO3 and a molecular weight of 411.38 g/mol. Its IUPAC name is (5S,8R,9R,10S,13R,14R)-9-bromo-10,13-dimethylspiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one.
| Compound Name | (5S,8R,9R,10S,13R,14R)-9-bromo-10,13-dimethylspiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one |
|---|---|
| PubChem CID | 125031025 |
| Molecular Formula | C21H31BrO3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (5S,8R,9R,10S,13R,14R)-9-bromo-10,13-dimethylspiro[1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-11-one |
| SMILES | C[C@]12CCC[C@@H]1[C@H]1CC[C@H]3CC4(CC[C@]3(C)[C@@]1(Br)C(=O)C2)OCCO4 |
| InChI | InChI=1S/C21H31BrO3/c1-18-7-3-4-15(18)16-6-5-14-12-20(24-10-11-25-20)9-8-19(14,2)21(16,22)17(23)13-18/h14-16H,3-13H2,1-2H3/t14-,15+,16+,18+,19-,21-/m0/s1 |
| InChIKey | LDUIALZUIXGSBK-XWKJIACPSA-N |
| XLogP | 4.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|