C19H22O3 — CID 125033952
(1S,2S,10R,11S,15S,17S)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene-5,14-dione (PubChem CID 125033952) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1S,2S,10R,11S,15S,17S)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene-5,14-dione.
| Compound Name | (1S,2S,10R,11S,15S,17S)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene-5,14-dione |
|---|---|
| PubChem CID | 125033952 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1S,2S,10R,11S,15S,17S)-2,15-dimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene-5,14-dione |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]3CCC(=O)[C@@]3(C)C[C@@H]3O[C@@]312 |
| InChI | InChI=1S/C19H22O3/c1-17-10-16-19(22-16)14(13(17)5-6-15(17)21)4-3-11-9-12(20)7-8-18(11,19)2/h7-9,13-14,16H,3-6,10H2,1-2H3/t13-,14+,16-,17-,18-,19+/m0/s1 |
| InChIKey | GCLIXCGWTLQNCF-JIYJMNMHSA-N |
| XLogP | 2.99 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|