C24H28O7 — CID 56610039
(1'S,2'S,9R,10'S,11'S,15'S,17'S)-2',15'-dimethylspiro[1,3,6-trioxonane-9,14'-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene]-5,5',8-trione (PubChem CID 56610039) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is (1'S,2'S,9R,10'S,11'S,15'S,17'S)-2',15'-dimethylspiro[1,3,6-trioxonane-9,14'-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene]-5,5',8-trione.
| Compound Name | (1'S,2'S,9R,10'S,11'S,15'S,17'S)-2',15'-dimethylspiro[1,3,6-trioxonane-9,14'-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene]-5,5',8-trione |
|---|---|
| PubChem CID | 56610039 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (1'S,2'S,9R,10'S,11'S,15'S,17'S)-2',15'-dimethylspiro[1,3,6-trioxonane-9,14'-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-diene]-5,5',8-trione |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CC[C@@]4(OCOCC(=O)OCC4=O)[C@@]3(C)C[C@@H]3O[C@@]312 |
| InChI | InChI=1S/C24H28O7/c1-21-7-5-15(25)9-14(21)3-4-17-16-6-8-23(22(16,2)10-19-24(17,21)31-19)18(26)11-29-20(27)12-28-13-30-23/h5,7,9,16-17,19H,3-4,6,8,10-13H2,1-2H3/t16-,17-,19-,21-,22-,23-,24+/m0/s1 |
| InChIKey | CVVQUWXSXAMZJP-GFPJEMOGSA-N |
| XLogP | 2.28 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|