C24H29FO5S — CID 10343648
[(2S,14R,15S,17S)-14-(fluoromethylsulfanylcarbonyl)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] propanoate (PubChem CID 10343648) has the molecular formula C24H29FO5S and a molecular weight of 448.56 g/mol. Its IUPAC name is [(2S,14R,15S,17S)-14-(fluoromethylsulfanylcarbonyl)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] propanoate.
| Compound Name | [(2S,14R,15S,17S)-14-(fluoromethylsulfanylcarbonyl)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] propanoate |
|---|---|
| PubChem CID | 10343648 |
| Molecular Formula | C24H29FO5S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(2S,14R,15S,17S)-14-(fluoromethylsulfanylcarbonyl)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)SCF)CCC2C3CCC4=CC(=O)C=C[C@]4(C)C34O[C@H]4C[C@@]21C |
| InChI | InChI=1S/C24H29FO5S/c1-4-19(27)30-23(20(28)31-13-25)10-8-16-17-6-5-14-11-15(26)7-9-21(14,2)24(17)18(29-24)12-22(16,23)3/h7,9,11,16-18H,4-6,8,10,12-13H2,1-3H3/t16?,17?,18-,21-,22-,23-,24?/m0/s1 |
| InChIKey | MZSZJPPLDQQHMZ-NJZJGHOUSA-N |
| XLogP | 4.30 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|