C8H12Br2O — CID 125035268
(1R,2R,6S)-7,7-dibromo-2-methoxybicyclo[4.1.0]heptane (PubChem CID 125035268) has the molecular formula C8H12Br2O and a molecular weight of 283.99 g/mol. Its IUPAC name is (1R,2R,6S)-7,7-dibromo-2-methoxybicyclo[4.1.0]heptane.
| Compound Name | (1R,2R,6S)-7,7-dibromo-2-methoxybicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 125035268 |
| Molecular Formula | C8H12Br2O |
| Molecular Weight | 283.99 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | (1R,2R,6S)-7,7-dibromo-2-methoxybicyclo[4.1.0]heptane |
| SMILES | CO[C@@H]1CCC[C@H]2[C@H]1C2(Br)Br |
| InChI | InChI=1S/C8H12Br2O/c1-11-6-4-2-3-5-7(6)8(5,9)10/h5-7H,2-4H2,1H3/t5-,6+,7+/m0/s1 |
| InChIKey | OLRVKYLBEIFIAW-RRKCRQDMSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.99 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|