C8H12Br2 — CID 124921029
(1S,2R,6S)-7,7-dibromo-2-methylbicyclo[4.1.0]heptane (PubChem CID 124921029) has the molecular formula C8H12Br2 and a molecular weight of 267.99 g/mol. Its IUPAC name is (1S,2R,6S)-7,7-dibromo-2-methylbicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,6S)-7,7-dibromo-2-methylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 124921029 |
| Molecular Formula | C8H12Br2 |
| Molecular Weight | 267.99 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | (1S,2R,6S)-7,7-dibromo-2-methylbicyclo[4.1.0]heptane |
| SMILES | C[C@@H]1CCC[C@H]2[C@H]1C2(Br)Br |
| InChI | InChI=1S/C8H12Br2/c1-5-3-2-4-6-7(5)8(6,9)10/h5-7H,2-4H2,1H3/t5-,6+,7+/m1/s1 |
| InChIKey | DDLGYTAQJREHKY-VQVTYTSYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|