C10H16Br2 — CID 12759792
10,10-dibromobicyclo[7.1.0]decane (PubChem CID 12759792) has the molecular formula C10H16Br2 and a molecular weight of 296.05 g/mol. Its IUPAC name is 10,10-dibromobicyclo[7.1.0]decane.
| Compound Name | 10,10-dibromobicyclo[7.1.0]decane |
|---|---|
| PubChem CID | 12759792 |
| Molecular Formula | C10H16Br2 |
| Molecular Weight | 296.05 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 10,10-dibromobicyclo[7.1.0]decane |
| SMILES | BrC1(Br)C2CCCCCCCC21 |
| InChI | InChI=1S/C10H16Br2/c11-10(12)8-6-4-2-1-3-5-7-9(8)10/h8-9H,1-7H2 |
| InChIKey | WLQQXRGTTTXPHN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.05 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|