C13H16Br4 — CID 90487319
4,4,13,13-tetrabromotetracyclo[5.5.1.01,7.03,5]tridecane (PubChem CID 90487319) has the molecular formula C13H16Br4 and a molecular weight of 491.89 g/mol. Its IUPAC name is 4,4,13,13-tetrabromotetracyclo[5.5.1.01,7.03,5]tridecane.
| Compound Name | 4,4,13,13-tetrabromotetracyclo[5.5.1.01,7.03,5]tridecane |
|---|---|
| PubChem CID | 90487319 |
| Molecular Formula | C13H16Br4 |
| Molecular Weight | 491.89 g/mol |
| Exact Mass | 487.80 |
| IUPAC Name | 4,4,13,13-tetrabromotetracyclo[5.5.1.01,7.03,5]tridecane |
| SMILES | BrC1(Br)C2CC34CCCCCC3(CC21)C4(Br)Br |
| InChI | InChI=1S/C13H16Br4/c14-12(15)8-6-10-4-2-1-3-5-11(10,7-9(8)12)13(10,16)17/h8-9H,1-7H2 |
| InChIKey | CQFXRXUWFPKYOI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.89 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|