C10H12Br2 — CID 101344345
(1S,6R)-10,10-dibromotricyclo[4.3.1.01,6]dec-3-ene (PubChem CID 101344345) has the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. Its IUPAC name is (1S,6R)-10,10-dibromotricyclo[4.3.1.01,6]dec-3-ene.
| Compound Name | (1S,6R)-10,10-dibromotricyclo[4.3.1.01,6]dec-3-ene |
|---|---|
| PubChem CID | 101344345 |
| Molecular Formula | C10H12Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | (1S,6R)-10,10-dibromotricyclo[4.3.1.01,6]dec-3-ene |
| SMILES | BrC1(Br)[C@@]23CC=CC[C@@]12CCC3 |
| InChI | InChI=1S/C10H12Br2/c11-10(12)8-4-1-2-5-9(8,10)7-3-6-8/h1-2H,3-7H2/t8-,9+ |
| InChIKey | HDMXOFNREFYKDS-DTORHVGOSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|