C13H14Br4 — CID 124525820
(1S,2S,6R,8S)-12,12,13,13-tetrabromopentacyclo[6.3.1.12,6.01,8.02,6]tridecane (PubChem CID 124525820) has the molecular formula C13H14Br4 and a molecular weight of 489.87 g/mol. Its IUPAC name is (1S,2S,6R,8S)-12,12,13,13-tetrabromopentacyclo[6.3.1.12,6.01,8.02,6]tridecane.
| Compound Name | (1S,2S,6R,8S)-12,12,13,13-tetrabromopentacyclo[6.3.1.12,6.01,8.02,6]tridecane |
|---|---|
| PubChem CID | 124525820 |
| Molecular Formula | C13H14Br4 |
| Molecular Weight | 489.87 g/mol |
| Exact Mass | 485.78 |
| IUPAC Name | (1S,2S,6R,8S)-12,12,13,13-tetrabromopentacyclo[6.3.1.12,6.01,8.02,6]tridecane |
| SMILES | BrC1(Br)[C@@]23CCC[C@]12[C@]12CCC[C@@]1(C3)C2(Br)Br |
| InChI | InChI=1S/C13H14Br4/c14-12(15)8-3-1-5-10(8,12)11-6-2-4-9(11,7-8)13(11,16)17/h1-7H2/t8-,9+,10-,11-/m0/s1 |
| InChIKey | NDFBFCVNLYJJFG-VLEAKVRGSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.87 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|