C16H20Br4 — CID 10602322
(1R,2R,6R,8S,9S,11R)-6,8,9,11-tetrabromopentacyclo[9.3.1.12,6.01,9.02,8]hexadecane (PubChem CID 10602322) has the molecular formula C16H20Br4 and a molecular weight of 531.95 g/mol. Its IUPAC name is (1R,2R,6R,8S,9S,11R)-6,8,9,11-tetrabromopentacyclo[9.3.1.12,6.01,9.02,8]hexadecane.
| Compound Name | (1R,2R,6R,8S,9S,11R)-6,8,9,11-tetrabromopentacyclo[9.3.1.12,6.01,9.02,8]hexadecane |
|---|---|
| PubChem CID | 10602322 |
| Molecular Formula | C16H20Br4 |
| Molecular Weight | 531.95 g/mol |
| Exact Mass | 527.83 |
| IUPAC Name | (1R,2R,6R,8S,9S,11R)-6,8,9,11-tetrabromopentacyclo[9.3.1.12,6.01,9.02,8]hexadecane |
| SMILES | Br[C@]12CCC[C@]3(C1)[C@@](Br)(C2)[C@]1(Br)C[C@@]2(Br)CCC[C@]13C2 |
| InChI | InChI=1S/C16H20Br4/c17-11-3-1-5-13(7-11)14-6-2-4-12(18,8-14)10-16(14,20)15(13,19)9-11/h1-10H2/t11-,12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | RMOMRVSNGMXPAW-JQOWZUPLSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.95 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|