C11H12Br4 — CID 117071048
(3R,5S)-4,4,11,11-tetrabromotetracyclo[5.3.1.01,7.03,5]undecane (PubChem CID 117071048) has the molecular formula C11H12Br4 and a molecular weight of 463.83 g/mol. Its IUPAC name is (3R,5S)-4,4,11,11-tetrabromotetracyclo[5.3.1.01,7.03,5]undecane.
| Compound Name | (3R,5S)-4,4,11,11-tetrabromotetracyclo[5.3.1.01,7.03,5]undecane |
|---|---|
| PubChem CID | 117071048 |
| Molecular Formula | C11H12Br4 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 459.77 |
| IUPAC Name | (3R,5S)-4,4,11,11-tetrabromotetracyclo[5.3.1.01,7.03,5]undecane |
| SMILES | BrC1(Br)[C@@H]2CC34CCCC3(C[C@@H]21)C4(Br)Br |
| InChI | InChI=1S/C11H12Br4/c12-10(13)6-4-8-2-1-3-9(8,5-7(6)10)11(8,14)15/h6-7H,1-5H2/t6-,7+,8?,9? |
| InChIKey | SHUNOWAARWMKLM-QPIHLSAKSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|