C11H18Br2 — CID 12759798
11,11-dibromobicyclo[8.1.0]undecane (PubChem CID 12759798) has the molecular formula C11H18Br2 and a molecular weight of 310.07 g/mol. Its IUPAC name is 11,11-dibromobicyclo[8.1.0]undecane.
| Compound Name | 11,11-dibromobicyclo[8.1.0]undecane |
|---|---|
| PubChem CID | 12759798 |
| Molecular Formula | C11H18Br2 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 11,11-dibromobicyclo[8.1.0]undecane |
| SMILES | BrC1(Br)C2CCCCCCCCC21 |
| InChI | InChI=1S/C11H18Br2/c12-11(13)9-7-5-3-1-2-4-6-8-10(9)11/h9-10H,1-8H2 |
| InChIKey | HHUURFZEMBTMKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|