About 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane]
1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] (PubChem CID 135061399) has the molecular formula C11H16BrF
and a molecular weight of 247.15 g/mol. Its IUPAC name is 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane].
Molecular Properties
| Compound Name | 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] |
| PubChem CID | 135061399 |
| Molecular Formula | C11H16BrF |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] |
| SMILES | FC1(Br)CC12C1CCCCCCC12 |
| InChI | InChI=1S/C11H16BrF/c12-11(13)7-10(11)8-5-3-1-2-4-6-9(8)10/h8-9H,1-7H2 |
| InChIKey | FBRCJKSQQNTQAD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane]?
The IUPAC name of 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] (CID 135061399) is 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane].
What is the SMILES notation for 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane]?
The canonical SMILES for 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] is FC1(Br)CC12C1CCCCCCC12.
What is the InChIKey of 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane]?
The InChIKey is FBRCJKSQQNTQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrF/c12-11(13)7-10(11)8-5-3-1-2-4-6-9(8)10/h8-9H,1-7H2.
What are the key properties of 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane]?
1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] has a molecular weight of 247.15 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-bromo-1'-fluorospiro[bicyclo[6.1.0]nonane-9,2'-cyclopropane] is sourced from PubChem (CID 135061399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).