C9H12Br2 — CID 98156795
(1S,4E,8S)-9,9-dibromobicyclo[6.1.0]non-4-ene (PubChem CID 98156795) has the molecular formula C9H12Br2 and a molecular weight of 280.00 g/mol. Its IUPAC name is (1S,4E,8S)-9,9-dibromobicyclo[6.1.0]non-4-ene.
| Compound Name | (1S,4E,8S)-9,9-dibromobicyclo[6.1.0]non-4-ene |
|---|---|
| PubChem CID | 98156795 |
| Molecular Formula | C9H12Br2 |
| Molecular Weight | 280.00 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | (1S,4E,8S)-9,9-dibromobicyclo[6.1.0]non-4-ene |
| SMILES | BrC1(Br)[C@H]2CC/C=C\CC[C@@H]21 |
| InChI | InChI=1S/C9H12Br2/c10-9(11)7-5-3-1-2-4-6-8(7)9/h1-2,7-8H,3-6H2/b2-1-/t7-,8-/m0/s1 |
| InChIKey | STKCBSOKXZTMOU-BNPBDYDZSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.00 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|