C10H12Br4 — CID 1220422
(1R,4R,6S,9S)-5,5,10,10-tetrabromotricyclo[7.1.0.04,6]decane (PubChem CID 1220422) has the molecular formula C10H12Br4 and a molecular weight of 451.82 g/mol. Its IUPAC name is (1R,4R,6S,9S)-5,5,10,10-tetrabromotricyclo[7.1.0.04,6]decane.
| Compound Name | (1R,4R,6S,9S)-5,5,10,10-tetrabromotricyclo[7.1.0.04,6]decane |
|---|---|
| PubChem CID | 1220422 |
| Molecular Formula | C10H12Br4 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 447.77 |
| IUPAC Name | (1R,4R,6S,9S)-5,5,10,10-tetrabromotricyclo[7.1.0.04,6]decane |
| SMILES | BrC1(Br)[C@@H]2CC[C@@H]3[C@H](CC[C@@H]21)C3(Br)Br |
| InChI | InChI=1S/C10H12Br4/c11-9(12)5-1-2-6-8(10(6,13)14)4-3-7(5)9/h5-8H,1-4H2/t5-,6-,7+,8+ |
| InChIKey | CBZFVWOOXISXFJ-ODANAHCNSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|