C9H14Br2FN — CID 130708187
7,7-dibromo-3-(3-fluoropropyl)-3-azabicyclo[4.1.0]heptane (PubChem CID 130708187) has the molecular formula C9H14Br2FN and a molecular weight of 315.02 g/mol. Its IUPAC name is 7,7-dibromo-3-(3-fluoropropyl)-3-azabicyclo[4.1.0]heptane.
| Compound Name | 7,7-dibromo-3-(3-fluoropropyl)-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 130708187 |
| Molecular Formula | C9H14Br2FN |
| Molecular Weight | 315.02 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 7,7-dibromo-3-(3-fluoropropyl)-3-azabicyclo[4.1.0]heptane |
| SMILES | FCCCN1CCC2C(C1)C2(Br)Br |
| InChI | InChI=1S/C9H14Br2FN/c10-9(11)7-2-5-13(4-1-3-12)6-8(7)9/h7-8H,1-6H2 |
| InChIKey | GVLTXJNHXUACMI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.02 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|