C14H18BrF2NO — CID 169239690
(4-bromo-2-fluorophenyl)-[1-(3-fluoropropyl)pyrrolidin-3-yl]methanol (PubChem CID 169239690) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-[1-(3-fluoropropyl)pyrrolidin-3-yl]methanol.
| Compound Name | (4-bromo-2-fluorophenyl)-[1-(3-fluoropropyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 169239690 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-[1-(3-fluoropropyl)pyrrolidin-3-yl]methanol |
| SMILES | OC(c1ccc(Br)cc1F)C1CCN(CCCF)C1 |
| InChI | InChI=1S/C14H18BrF2NO/c15-11-2-3-12(13(17)8-11)14(19)10-4-7-18(9-10)6-1-5-16/h2-3,8,10,14,19H,1,4-7,9H2 |
| InChIKey | GWRGSUXVMNTHSM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |