C12H14Br4O — CID 11813008
(1S,3R,5R,7R)-4,4,11,11-tetrabromo-3-methoxytetracyclo[5.3.1.01,7.03,5]undecane (PubChem CID 11813008) has the molecular formula C12H14Br4O and a molecular weight of 493.86 g/mol. Its IUPAC name is (1S,3R,5R,7R)-4,4,11,11-tetrabromo-3-methoxytetracyclo[5.3.1.01,7.03,5]undecane.
| Compound Name | (1S,3R,5R,7R)-4,4,11,11-tetrabromo-3-methoxytetracyclo[5.3.1.01,7.03,5]undecane |
|---|---|
| PubChem CID | 11813008 |
| Molecular Formula | C12H14Br4O |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 489.78 |
| IUPAC Name | (1S,3R,5R,7R)-4,4,11,11-tetrabromo-3-methoxytetracyclo[5.3.1.01,7.03,5]undecane |
| SMILES | CO[C@]12C[C@@]34CCC[C@]3(C[C@H]1C2(Br)Br)C4(Br)Br |
| InChI | InChI=1S/C12H14Br4O/c1-17-10-6-9-4-2-3-8(9,12(9,15)16)5-7(10)11(10,13)14/h7H,2-6H2,1H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | SXOBADQICWIUOE-DOLQZWNJSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|