C12H16Cl4 — CID 13412659
2,2,5,5-tetrachlorodispiro[2.0.24.63]dodecane (PubChem CID 13412659) has the molecular formula C12H16Cl4 and a molecular weight of 302.07 g/mol. Its IUPAC name is 2,2,5,5-tetrachlorodispiro[2.0.24.63]dodecane.
| Compound Name | 2,2,5,5-tetrachlorodispiro[2.0.24.63]dodecane |
|---|---|
| PubChem CID | 13412659 |
| Molecular Formula | C12H16Cl4 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2,2,5,5-tetrachlorodispiro[2.0.24.63]dodecane |
| SMILES | ClC1(Cl)CC12CCCCCCC21CC1(Cl)Cl |
| InChI | InChI=1S/C12H16Cl4/c13-11(14)7-9(11)5-3-1-2-4-6-10(9)8-12(10,15)16/h1-8H2 |
| InChIKey | KTWPBKOGZHKLQD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|