About 1,1-dichlorocyclopentane;dihydrochloride
1,1-dichlorocyclopentane;dihydrochloride (PubChem CID 146484844) has the molecular formula C5H10Cl4
and a molecular weight of 211.95 g/mol. Its IUPAC name is 1,1-dichlorocyclopentane;dihydrochloride.
Molecular Properties
| Compound Name | 1,1-dichlorocyclopentane;dihydrochloride |
| PubChem CID | 146484844 |
| Molecular Formula | C5H10Cl4 |
| Molecular Weight | 211.95 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 1,1-dichlorocyclopentane;dihydrochloride |
| SMILES | Cl.Cl.ClC1(Cl)CCCC1 |
| InChI | InChI=1S/C5H8Cl2.2ClH/c6-5(7)3-1-2-4-5;;/h1-4H2;2*1H |
| InChIKey | JAYURGKBOCTQNA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorocyclopentane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorocyclopentane;dihydrochloride?
The IUPAC name of 1,1-dichlorocyclopentane;dihydrochloride (CID 146484844) is 1,1-dichlorocyclopentane;dihydrochloride.
What is the SMILES notation for 1,1-dichlorocyclopentane;dihydrochloride?
The canonical SMILES for 1,1-dichlorocyclopentane;dihydrochloride is Cl.Cl.ClC1(Cl)CCCC1.
What is the InChIKey of 1,1-dichlorocyclopentane;dihydrochloride?
The InChIKey is JAYURGKBOCTQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8Cl2.2ClH/c6-5(7)3-1-2-4-5;;/h1-4H2;2*1H.
What are the key properties of 1,1-dichlorocyclopentane;dihydrochloride?
1,1-dichlorocyclopentane;dihydrochloride has a molecular weight of 211.95 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorocyclopentane;dihydrochloride is sourced from PubChem (CID 146484844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).