About 1,1-dichlorocyclobutane;hydrofluoride
1,1-dichlorocyclobutane;hydrofluoride (PubChem CID 174902728) has the molecular formula C4H7Cl2F
and a molecular weight of 145.00 g/mol. Its IUPAC name is 1,1-dichlorocyclobutane;hydrofluoride.
Molecular Properties
| Compound Name | 1,1-dichlorocyclobutane;hydrofluoride |
| PubChem CID | 174902728 |
| Molecular Formula | C4H7Cl2F |
| Molecular Weight | 145.00 g/mol |
| Exact Mass | 143.99 |
| IUPAC Name | 1,1-dichlorocyclobutane;hydrofluoride |
| SMILES | ClC1(Cl)CCC1.F |
| InChI | InChI=1S/C4H6Cl2.FH/c5-4(6)2-1-3-4;/h1-3H2;1H |
| InChIKey | KBYDZKRBITYOOK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.00 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorocyclobutane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorocyclobutane;hydrofluoride?
The IUPAC name of 1,1-dichlorocyclobutane;hydrofluoride (CID 174902728) is 1,1-dichlorocyclobutane;hydrofluoride.
What is the SMILES notation for 1,1-dichlorocyclobutane;hydrofluoride?
The canonical SMILES for 1,1-dichlorocyclobutane;hydrofluoride is ClC1(Cl)CCC1.F.
What is the InChIKey of 1,1-dichlorocyclobutane;hydrofluoride?
The InChIKey is KBYDZKRBITYOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl2.FH/c5-4(6)2-1-3-4;/h1-3H2;1H.
What are the key properties of 1,1-dichlorocyclobutane;hydrofluoride?
1,1-dichlorocyclobutane;hydrofluoride has a molecular weight of 145.00 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorocyclobutane;hydrofluoride is sourced from PubChem (CID 174902728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).