C10H10Cl10 — CID 71370874
1,1,2,2,3,3,4,4,5,5-decachlorocyclodecane (PubChem CID 71370874) has the molecular formula C10H10Cl10 and a molecular weight of 484.72 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decachlorocyclodecane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decachlorocyclodecane |
|---|---|
| PubChem CID | 71370874 |
| Molecular Formula | C10H10Cl10 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 479.77 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decachlorocyclodecane |
| SMILES | ClC1(Cl)CCCCCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H10Cl10/c11-6(12)4-2-1-3-5-7(13,14)9(17,18)10(19,20)8(6,15)16/h1-5H2 |
| InChIKey | VPKFJSDWUMREPL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|