C6H10Cl4N2Pt — CID 88701201
platinum;2,2,3,3-tetrachlorocyclohexane-1,1-diamine (PubChem CID 88701201) has the molecular formula C6H10Cl4N2Pt and a molecular weight of 447.05 g/mol. Its IUPAC name is platinum;2,2,3,3-tetrachlorocyclohexane-1,1-diamine.
| Compound Name | platinum;2,2,3,3-tetrachlorocyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 88701201 |
| Molecular Formula | C6H10Cl4N2Pt |
| Molecular Weight | 447.05 g/mol |
| Exact Mass | 444.92 |
| IUPAC Name | platinum;2,2,3,3-tetrachlorocyclohexane-1,1-diamine |
| SMILES | NC1(N)CCCC(Cl)(Cl)C1(Cl)Cl.[Pt] |
| InChI | InChI=1S/C6H10Cl4N2.Pt/c7-4(8)2-1-3-5(11,12)6(4,9)10;/h1-3,11-12H2; |
| InChIKey | GFAJHNNIOHPJPB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.05 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|