C6H8Cl3FO2 — CID 18970946
2,2,6-trichloro-6-fluorocyclohexane-1,1-diol (PubChem CID 18970946) has the molecular formula C6H8Cl3FO2 and a molecular weight of 237.48 g/mol. Its IUPAC name is 2,2,6-trichloro-6-fluorocyclohexane-1,1-diol.
| Compound Name | 2,2,6-trichloro-6-fluorocyclohexane-1,1-diol |
|---|---|
| PubChem CID | 18970946 |
| Molecular Formula | C6H8Cl3FO2 |
| Molecular Weight | 237.48 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2,2,6-trichloro-6-fluorocyclohexane-1,1-diol |
| SMILES | OC1(O)C(F)(Cl)CCCC1(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3FO2/c7-4(8)2-1-3-5(9,10)6(4,11)12/h11-12H,1-3H2 |
| InChIKey | VUCXFCSHAHXIKU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|