C7H8Cl3NO2 — CID 51381490
(1S,6R)-2,2,6-trichloro-7-oxabicyclo[4.1.0]heptane-1-carboxamide (PubChem CID 51381490) has the molecular formula C7H8Cl3NO2 and a molecular weight of 244.50 g/mol. Its IUPAC name is (1S,6R)-2,2,6-trichloro-7-oxabicyclo[4.1.0]heptane-1-carboxamide.
| Compound Name | (1S,6R)-2,2,6-trichloro-7-oxabicyclo[4.1.0]heptane-1-carboxamide |
|---|---|
| PubChem CID | 51381490 |
| Molecular Formula | C7H8Cl3NO2 |
| Molecular Weight | 244.50 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | (1S,6R)-2,2,6-trichloro-7-oxabicyclo[4.1.0]heptane-1-carboxamide |
| SMILES | NC(=O)[C@]12O[C@@]1(Cl)CCCC2(Cl)Cl |
| InChI | InChI=1S/C7H8Cl3NO2/c8-5(9)2-1-3-6(10)7(5,13-6)4(11)12/h1-3H2,(H2,11,12)/t6-,7+/m0/s1 |
| InChIKey | RJDOGZFPFXYFDM-NKWVEPMBSA-N |
| XLogP | 1.53 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|