C6H12N4O4 — CID 163541428
2,5-diamino-1,4-dioxane-2,5-dicarboxamide (PubChem CID 163541428) has the molecular formula C6H12N4O4 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2,5-diamino-1,4-dioxane-2,5-dicarboxamide.
| Compound Name | 2,5-diamino-1,4-dioxane-2,5-dicarboxamide |
|---|---|
| PubChem CID | 163541428 |
| Molecular Formula | C6H12N4O4 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2,5-diamino-1,4-dioxane-2,5-dicarboxamide |
| SMILES | NC(=O)C1(N)COC(N)(C(N)=O)CO1 |
| InChI | InChI=1S/C6H12N4O4/c7-3(11)5(9)1-13-6(10,2-14-5)4(8)12/h1-2,9-10H2,(H2,7,11)(H2,8,12) |
| InChIKey | FBKFRWQGWQKCDP-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |