C6H9F2NO2 — CID 162570093
(2R)-4,4-difluoro-2-methyloxolane-2-carboxamide (PubChem CID 162570093) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-methyloxolane-2-carboxamide.
| Compound Name | (2R)-4,4-difluoro-2-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 162570093 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2R)-4,4-difluoro-2-methyloxolane-2-carboxamide |
| SMILES | C[C@]1(C(N)=O)CC(F)(F)CO1 |
| InChI | InChI=1S/C6H9F2NO2/c1-5(4(9)10)2-6(7,8)3-11-5/h2-3H2,1H3,(H2,9,10)/t5-/m1/s1 |
| InChIKey | PALHTPPPPHIMJT-RXMQYKEDSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |