C14H29NO2 — CID 144562151
(2S)-2-amino-4-methyl-1-(2-methyloxiran-2-yl)pentan-1-one;ethane;prop-1-ene (PubChem CID 144562151) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-1-(2-methyloxiran-2-yl)pentan-1-one;ethane;prop-1-ene.
| Compound Name | (2S)-2-amino-4-methyl-1-(2-methyloxiran-2-yl)pentan-1-one;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144562151 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | (2S)-2-amino-4-methyl-1-(2-methyloxiran-2-yl)pentan-1-one;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC(C)C[C@H](N)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C9H17NO2.C3H6.C2H6/c1-6(2)4-7(10)8(11)9(3)5-12-9;1-3-2;1-2/h6-7H,4-5,10H2,1-3H3;3H,1H2,2H3;1-2H3/t7-,9?;;/m0../s1 |
| InChIKey | VNXFUDQVJWTQSA-UOOUTUCWSA-N |
| XLogP | 2.94 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|