C6H9NO5 — CID 175257803
2-carbamoyl-1,4-dioxane-2-carboxylic acid (PubChem CID 175257803) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is 2-carbamoyl-1,4-dioxane-2-carboxylic acid.
| Compound Name | 2-carbamoyl-1,4-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 175257803 |
| Molecular Formula | C6H9NO5 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 2-carbamoyl-1,4-dioxane-2-carboxylic acid |
| SMILES | NC(=O)C1(C(=O)O)COCCO1 |
| InChI | InChI=1S/C6H9NO5/c7-4(8)6(5(9)10)3-11-1-2-12-6/h1-3H2,(H2,7,8)(H,9,10) |
| InChIKey | WLODIYDPZVDTFO-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|