2-carbamoyl-1,4-dioxane-2-carboxylic acid

C6H9NO5 — CID 175257803

IUPAC2-carbamoyl-1,4-dioxane-2-carboxylic acid
SMILESNC(=O)C1(C(=O)O)COCCO1
InChIInChI=1S/C6H9NO5/c7-4(8)6(5(9)10)3-11-1-2-12-6/h1-3H2,(H2,7,8)(H,9,10)
InChIKeyWLODIYDPZVDTFO-UHFFFAOYSA-N
MW175.14 g/mol
LogP-1.66
Rot. Bonds2

About 2-carbamoyl-1,4-dioxane-2-carboxylic acid

2-carbamoyl-1,4-dioxane-2-carboxylic acid (PubChem CID 175257803) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is 2-carbamoyl-1,4-dioxane-2-carboxylic acid.

Molecular Properties

Compound Name2-carbamoyl-1,4-dioxane-2-carboxylic acid
PubChem CID175257803
Molecular FormulaC6H9NO5
Molecular Weight175.14 g/mol
Exact Mass175.05
IUPAC Name2-carbamoyl-1,4-dioxane-2-carboxylic acid
SMILESNC(=O)C1(C(=O)O)COCCO1
InChIInChI=1S/C6H9NO5/c7-4(8)6(5(9)10)3-11-1-2-12-6/h1-3H2,(H2,7,8)(H,9,10)
InChIKeyWLODIYDPZVDTFO-UHFFFAOYSA-N
XLogP-1.66
TPSA98.85 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.14
LogP ≤ 5-1.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-carbamoyl-1,4-dioxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-carbamoyl-1,4-dioxane-2-carboxylic acid?
The IUPAC name of 2-carbamoyl-1,4-dioxane-2-carboxylic acid (CID 175257803) is 2-carbamoyl-1,4-dioxane-2-carboxylic acid.
What is the SMILES notation for 2-carbamoyl-1,4-dioxane-2-carboxylic acid?
The canonical SMILES for 2-carbamoyl-1,4-dioxane-2-carboxylic acid is NC(=O)C1(C(=O)O)COCCO1.
What is the InChIKey of 2-carbamoyl-1,4-dioxane-2-carboxylic acid?
The InChIKey is WLODIYDPZVDTFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO5/c7-4(8)6(5(9)10)3-11-1-2-12-6/h1-3H2,(H2,7,8)(H,9,10).
What are the key properties of 2-carbamoyl-1,4-dioxane-2-carboxylic acid?
2-carbamoyl-1,4-dioxane-2-carboxylic acid has a molecular weight of 175.14 g/mol, XLogP of -1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyl-1,4-dioxane-2-carboxylic acid is sourced from PubChem (CID 175257803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).