2-acetyloxy-1,4-dioxane-2-carboxylic acid

C7H10O6 — CID 175607974

IUPAC2-acetyloxy-1,4-dioxane-2-carboxylic acid
SMILESCC(=O)OC1(C(=O)O)COCCO1
InChIInChI=1S/C7H10O6/c1-5(8)13-7(6(9)10)4-11-2-3-12-7/h2-4H2,1H3,(H,9,10)
InChIKeyRGEOQLFLPHSTHQ-UHFFFAOYSA-N
MW190.15 g/mol
LogP-0.62
Rot. Bonds2

About 2-acetyloxy-1,4-dioxane-2-carboxylic acid

2-acetyloxy-1,4-dioxane-2-carboxylic acid (PubChem CID 175607974) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 2-acetyloxy-1,4-dioxane-2-carboxylic acid.

Molecular Properties

Compound Name2-acetyloxy-1,4-dioxane-2-carboxylic acid
PubChem CID175607974
Molecular FormulaC7H10O6
Molecular Weight190.15 g/mol
Exact Mass190.05
IUPAC Name2-acetyloxy-1,4-dioxane-2-carboxylic acid
SMILESCC(=O)OC1(C(=O)O)COCCO1
InChIInChI=1S/C7H10O6/c1-5(8)13-7(6(9)10)4-11-2-3-12-7/h2-4H2,1H3,(H,9,10)
InChIKeyRGEOQLFLPHSTHQ-UHFFFAOYSA-N
XLogP-0.62
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 5-0.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-acetyloxy-1,4-dioxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxy-1,4-dioxane-2-carboxylic acid?
The IUPAC name of 2-acetyloxy-1,4-dioxane-2-carboxylic acid (CID 175607974) is 2-acetyloxy-1,4-dioxane-2-carboxylic acid.
What is the SMILES notation for 2-acetyloxy-1,4-dioxane-2-carboxylic acid?
The canonical SMILES for 2-acetyloxy-1,4-dioxane-2-carboxylic acid is CC(=O)OC1(C(=O)O)COCCO1.
What is the InChIKey of 2-acetyloxy-1,4-dioxane-2-carboxylic acid?
The InChIKey is RGEOQLFLPHSTHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O6/c1-5(8)13-7(6(9)10)4-11-2-3-12-7/h2-4H2,1H3,(H,9,10).
What are the key properties of 2-acetyloxy-1,4-dioxane-2-carboxylic acid?
2-acetyloxy-1,4-dioxane-2-carboxylic acid has a molecular weight of 190.15 g/mol, XLogP of -0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxy-1,4-dioxane-2-carboxylic acid is sourced from PubChem (CID 175607974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).