C11H16 — CID 123157263
spiro[4.6]undeca-2,8-diene (PubChem CID 123157263) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is spiro[4.6]undeca-2,8-diene.
| Compound Name | spiro[4.6]undeca-2,8-diene |
|---|---|
| PubChem CID | 123157263 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | spiro[4.6]undeca-2,8-diene |
| SMILES | C1=CCCC2(CC=CC2)CC1 |
| InChI | InChI=1S/C11H16/c1-2-4-8-11(7-3-1)9-5-6-10-11/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | XYKLCDUNSNJIGS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|