C12H13BrO2 — CID 125035517
[(1R,2S,3R,6S,7R,10R)-10-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] acetate (PubChem CID 125035517) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is [(1R,2S,3R,6S,7R,10R)-10-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] acetate.
| Compound Name | [(1R,2S,3R,6S,7R,10R)-10-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] acetate |
|---|---|
| PubChem CID | 125035517 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | [(1R,2S,3R,6S,7R,10R)-10-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@H]2[C@H]3C=C[C@@H]([C@@H]3Br)[C@H]21 |
| InChI | InChI=1S/C12H13BrO2/c1-6(14)15-10-5-4-7-8-2-3-9(11(7)10)12(8)13/h2-5,7-12H,1H3/t7-,8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | PVTYTHDWFCMPGF-QSZMHOAKSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|