C18H19N3O — CID 12503556
(6R,7aR)-5,6-dimethyl-3,7a-diphenyl-6,7-dihydropyrazolo[1,5-d][1,2,4]oxadiazole (PubChem CID 12503556) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is (6R,7aR)-5,6-dimethyl-3,7a-diphenyl-6,7-dihydropyrazolo[1,5-d][1,2,4]oxadiazole.
| Compound Name | (6R,7aR)-5,6-dimethyl-3,7a-diphenyl-6,7-dihydropyrazolo[1,5-d][1,2,4]oxadiazole |
|---|---|
| PubChem CID | 12503556 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (6R,7aR)-5,6-dimethyl-3,7a-diphenyl-6,7-dihydropyrazolo[1,5-d][1,2,4]oxadiazole |
| SMILES | C[C@@H]1C[C@]2(c3ccccc3)ON=C(c3ccccc3)N2N1C |
| InChI | InChI=1S/C18H19N3O/c1-14-13-18(16-11-7-4-8-12-16)21(20(14)2)17(19-22-18)15-9-5-3-6-10-15/h3-12,14H,13H2,1-2H3/t14-,18-/m1/s1 |
| InChIKey | FDWLPEULCSKGMR-RDTXWAMCSA-N |
| XLogP | 3.17 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |