C15H14N2O — CID 12954952
4-methyl-3,5-diphenyl-5H-1,2,4-oxadiazole (PubChem CID 12954952) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-methyl-3,5-diphenyl-5H-1,2,4-oxadiazole.
| Compound Name | 4-methyl-3,5-diphenyl-5H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 12954952 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-methyl-3,5-diphenyl-5H-1,2,4-oxadiazole |
| SMILES | CN1C(c2ccccc2)=NOC1c1ccccc1 |
| InChI | InChI=1S/C15H14N2O/c1-17-14(12-8-4-2-5-9-12)16-18-15(17)13-10-6-3-7-11-13/h2-11,15H,1H3 |
| InChIKey | OUXGCQXWVJDDAL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |