C13H18N2O — CID 15257621
4-tert-butyl-3-methyl-5-phenyl-5H-1,2,4-oxadiazole (PubChem CID 15257621) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-tert-butyl-3-methyl-5-phenyl-5H-1,2,4-oxadiazole.
| Compound Name | 4-tert-butyl-3-methyl-5-phenyl-5H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15257621 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-tert-butyl-3-methyl-5-phenyl-5H-1,2,4-oxadiazole |
| SMILES | CC1=NOC(c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C13H18N2O/c1-10-14-16-12(15(10)13(2,3)4)11-8-6-5-7-9-11/h5-9,12H,1-4H3 |
| InChIKey | HIPUONJZDWHYDZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |